C15H23NO2 — CID 70229825
3-butoxy-5-[(1S,2R)-2-(2-methoxyethyl)cyclopropyl]pyridine (PubChem CID 70229825) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 3-butoxy-5-[(1S,2R)-2-(2-methoxyethyl)cyclopropyl]pyridine.
| Compound Name | 3-butoxy-5-[(1S,2R)-2-(2-methoxyethyl)cyclopropyl]pyridine |
|---|---|
| PubChem CID | 70229825 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 3-butoxy-5-[(1S,2R)-2-(2-methoxyethyl)cyclopropyl]pyridine |
| SMILES | CCCCOc1cncc([C@H]2C[C@@H]2CCOC)c1 |
| InChI | InChI=1S/C15H23NO2/c1-3-4-6-18-14-8-13(10-16-11-14)15-9-12(15)5-7-17-2/h8,10-12,15H,3-7,9H2,1-2H3/t12-,15-/m0/s1 |
| InChIKey | QHVJPJQIFIBCFG-WFASDCNBSA-N |
| XLogP | 3.40 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|