C12H18N6O4S2 — CID 68612130
ethyl 5-hydrazinyl-1,3-thiazole-4-carboxylate;2-ethyl-5-hydrazinyl-1,3-thiazole-4-carboxylic acid (PubChem CID 68612130) has the molecular formula C12H18N6O4S2 and a molecular weight of 374.45 g/mol. Its IUPAC name is ethyl 5-hydrazinyl-1,3-thiazole-4-carboxylate;2-ethyl-5-hydrazinyl-1,3-thiazole-4-carboxylic acid.
| Compound Name | ethyl 5-hydrazinyl-1,3-thiazole-4-carboxylate;2-ethyl-5-hydrazinyl-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 68612130 |
| Molecular Formula | C12H18N6O4S2 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | ethyl 5-hydrazinyl-1,3-thiazole-4-carboxylate;2-ethyl-5-hydrazinyl-1,3-thiazole-4-carboxylic acid |
| SMILES | CCOC(=O)c1ncsc1NN.CCc1nc(C(=O)O)c(NN)s1 |
| InChI | InChI=1S/2C6H9N3O2S/c1-2-11-6(10)4-5(9-7)12-3-8-4;1-2-3-8-4(6(10)11)5(9-7)12-3/h3,9H,2,7H2,1H3;9H,2,7H2,1H3,(H,10,11) |
| InChIKey | FDFDGUBAMLOWDW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 165.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|