C25H36ClN3O2 — CID 68612270
3-[3-(3-phenylmethoxypropyl)piperidin-1-yl]-5-[[(2S)-pyrrolidin-2-yl]methoxy]pyridine;hydrochloride (PubChem CID 68612270) has the molecular formula C25H36ClN3O2 and a molecular weight of 446.04 g/mol. Its IUPAC name is 3-[3-(3-phenylmethoxypropyl)piperidin-1-yl]-5-[[(2S)-pyrrolidin-2-yl]methoxy]pyridine;hydrochloride.
| Compound Name | 3-[3-(3-phenylmethoxypropyl)piperidin-1-yl]-5-[[(2S)-pyrrolidin-2-yl]methoxy]pyridine;hydrochloride |
|---|---|
| PubChem CID | 68612270 |
| Molecular Formula | C25H36ClN3O2 |
| Molecular Weight | 446.04 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | 3-[3-(3-phenylmethoxypropyl)piperidin-1-yl]-5-[[(2S)-pyrrolidin-2-yl]methoxy]pyridine;hydrochloride |
| SMILES | Cl.c1ccc(COCCCC2CCCN(c3cncc(OC[C@@H]4CCCN4)c3)C2)cc1 |
| InChI | InChI=1S/C25H35N3O2.ClH/c1-2-7-22(8-3-1)19-29-14-6-10-21-9-5-13-28(18-21)24-15-25(17-26-16-24)30-20-23-11-4-12-27-23;/h1-3,7-8,15-17,21,23,27H,4-6,9-14,18-20H2;1H/t21?,23-;/m0./s1 |
| InChIKey | CGXHRUUPQODSSC-RLDJWPNBSA-N |
| XLogP | 4.85 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.04 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|