C26H37N3O2 — CID 68612964
3-[2-(4-phenylmethoxybutyl)piperidin-1-yl]-5-[[(2S)-pyrrolidin-2-yl]methoxy]pyridine (PubChem CID 68612964) has the molecular formula C26H37N3O2 and a molecular weight of 423.60 g/mol. Its IUPAC name is 3-[2-(4-phenylmethoxybutyl)piperidin-1-yl]-5-[[(2S)-pyrrolidin-2-yl]methoxy]pyridine.
| Compound Name | 3-[2-(4-phenylmethoxybutyl)piperidin-1-yl]-5-[[(2S)-pyrrolidin-2-yl]methoxy]pyridine |
|---|---|
| PubChem CID | 68612964 |
| Molecular Formula | C26H37N3O2 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.29 |
| IUPAC Name | 3-[2-(4-phenylmethoxybutyl)piperidin-1-yl]-5-[[(2S)-pyrrolidin-2-yl]methoxy]pyridine |
| SMILES | c1ccc(COCCCCC2CCCCN2c2cncc(OC[C@@H]3CCCN3)c2)cc1 |
| InChI | InChI=1S/C26H37N3O2/c1-2-9-22(10-3-1)20-30-16-7-5-13-24-12-4-6-15-29(24)25-17-26(19-27-18-25)31-21-23-11-8-14-28-23/h1-3,9-10,17-19,23-24,28H,4-8,11-16,20-21H2/t23-,24?/m0/s1 |
| InChIKey | OEBKYJLWRDLUKJ-UXMRNZNESA-N |
| XLogP | 4.96 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|