C20H19ClN2O2 — CID 68615660
(3S)-1-[4-[(E)-2-(3-chlorophenyl)ethenyl]phenyl]-N-methyl-5-oxopyrrolidine-3-carboxamide (PubChem CID 68615660) has the molecular formula C20H19ClN2O2 and a molecular weight of 354.84 g/mol. Its IUPAC name is (3S)-1-[4-[(E)-2-(3-chlorophenyl)ethenyl]phenyl]-N-methyl-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-[4-[(E)-2-(3-chlorophenyl)ethenyl]phenyl]-N-methyl-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 68615660 |
| Molecular Formula | C20H19ClN2O2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | (3S)-1-[4-[(E)-2-(3-chlorophenyl)ethenyl]phenyl]-N-methyl-5-oxopyrrolidine-3-carboxamide |
| SMILES | CNC(=O)[C@H]1CC(=O)N(c2ccc(/C=C/c3cccc(Cl)c3)cc2)C1 |
| InChI | InChI=1S/C20H19ClN2O2/c1-22-20(25)16-12-19(24)23(13-16)18-9-7-14(8-10-18)5-6-15-3-2-4-17(21)11-15/h2-11,16H,12-13H2,1H3,(H,22,25)/b6-5+/t16-/m0/s1 |
| InChIKey | YQWIBADSRLKTPR-JFDDCEBESA-N |
| XLogP | 3.61 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|