C15H15NOS — CID 686161
(2-amino-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-phenylmethanone (PubChem CID 686161) has the molecular formula C15H15NOS and a molecular weight of 257.36 g/mol. Its IUPAC name is (2-amino-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-phenylmethanone.
| Compound Name | (2-amino-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-phenylmethanone |
|---|---|
| PubChem CID | 686161 |
| Molecular Formula | C15H15NOS |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | (2-amino-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-phenylmethanone |
| SMILES | Nc1sc2c(c1C(=O)c1ccccc1)CCCC2 |
| InChI | InChI=1S/C15H15NOS/c16-15-13(11-8-4-5-9-12(11)18-15)14(17)10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9,16H2 |
| InChIKey | QJCQJXOEXKINTC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|