C24H36N4O — CID 68621990
(4-propan-2-ylpiperazin-1-yl)-[1-(1-propylpiperidin-4-yl)indol-5-yl]methanone (PubChem CID 68621990) has the molecular formula C24H36N4O and a molecular weight of 396.58 g/mol. Its IUPAC name is (4-propan-2-ylpiperazin-1-yl)-[1-(1-propylpiperidin-4-yl)indol-5-yl]methanone.
| Compound Name | (4-propan-2-ylpiperazin-1-yl)-[1-(1-propylpiperidin-4-yl)indol-5-yl]methanone |
|---|---|
| PubChem CID | 68621990 |
| Molecular Formula | C24H36N4O |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | (4-propan-2-ylpiperazin-1-yl)-[1-(1-propylpiperidin-4-yl)indol-5-yl]methanone |
| SMILES | CCCN1CCC(n2ccc3cc(C(=O)N4CCN(C(C)C)CC4)ccc32)CC1 |
| InChI | InChI=1S/C24H36N4O/c1-4-10-25-11-8-22(9-12-25)28-13-7-20-18-21(5-6-23(20)28)24(29)27-16-14-26(15-17-27)19(2)3/h5-7,13,18-19,22H,4,8-12,14-17H2,1-3H3 |
| InChIKey | KZOSVKFLOLTQGN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 31.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |