C27H34N4O — CID 174568018
[1-(4-imino-5-phenylpentan-2-yl)indol-5-yl]-(4-propan-2-ylpiperazin-1-yl)methanone (PubChem CID 174568018) has the molecular formula C27H34N4O and a molecular weight of 430.60 g/mol. Its IUPAC name is [1-(4-imino-5-phenylpentan-2-yl)indol-5-yl]-(4-propan-2-ylpiperazin-1-yl)methanone.
| Compound Name | [1-(4-imino-5-phenylpentan-2-yl)indol-5-yl]-(4-propan-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 174568018 |
| Molecular Formula | C27H34N4O |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | [1-(4-imino-5-phenylpentan-2-yl)indol-5-yl]-(4-propan-2-ylpiperazin-1-yl)methanone |
| SMILES | [H]/N=C(\Cc1ccccc1)CC(C)n1ccc2cc(C(=O)N3CCN(C(C)C)CC3)ccc21 |
| InChI | InChI=1S/C27H34N4O/c1-20(2)29-13-15-30(16-14-29)27(32)24-9-10-26-23(19-24)11-12-31(26)21(3)17-25(28)18-22-7-5-4-6-8-22/h4-12,19-21,28H,13-18H2,1-3H3/b28-25- |
| InChIKey | MZQLPRRSNRJTSS-FVDSYPCUSA-N |
| XLogP | 5.02 |
| TPSA | 52.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|