C30H38N4O — CID 68622991
(4-cyclobutylpiperazin-1-yl)-[1-(2-phenyl-1-piperidin-3-ylethyl)indol-5-yl]methanone (PubChem CID 68622991) has the molecular formula C30H38N4O and a molecular weight of 470.66 g/mol. Its IUPAC name is (4-cyclobutylpiperazin-1-yl)-[1-(2-phenyl-1-piperidin-3-ylethyl)indol-5-yl]methanone.
| Compound Name | (4-cyclobutylpiperazin-1-yl)-[1-(2-phenyl-1-piperidin-3-ylethyl)indol-5-yl]methanone |
|---|---|
| PubChem CID | 68622991 |
| Molecular Formula | C30H38N4O |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | (4-cyclobutylpiperazin-1-yl)-[1-(2-phenyl-1-piperidin-3-ylethyl)indol-5-yl]methanone |
| SMILES | O=C(c1ccc2c(ccn2C(Cc2ccccc2)C2CCCNC2)c1)N1CCN(C2CCC2)CC1 |
| InChI | InChI=1S/C30H38N4O/c35-30(33-18-16-32(17-19-33)27-9-4-10-27)25-11-12-28-24(21-25)13-15-34(28)29(26-8-5-14-31-22-26)20-23-6-2-1-3-7-23/h1-3,6-7,11-13,15,21,26-27,29,31H,4-5,8-10,14,16-20,22H2 |
| InChIKey | FXIXSJKHPUCHLS-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |