C26H28N4O — CID 24986519
3-[[5-(4-cyclopentylpiperazine-1-carbonyl)indol-1-yl]methyl]benzonitrile (PubChem CID 24986519) has the molecular formula C26H28N4O and a molecular weight of 412.54 g/mol. Its IUPAC name is 3-[[5-(4-cyclopentylpiperazine-1-carbonyl)indol-1-yl]methyl]benzonitrile.
| Compound Name | 3-[[5-(4-cyclopentylpiperazine-1-carbonyl)indol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 24986519 |
| Molecular Formula | C26H28N4O |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 3-[[5-(4-cyclopentylpiperazine-1-carbonyl)indol-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1cccc(Cn2ccc3cc(C(=O)N4CCN(C5CCCC5)CC4)ccc32)c1 |
| InChI | InChI=1S/C26H28N4O/c27-18-20-4-3-5-21(16-20)19-30-11-10-22-17-23(8-9-25(22)30)26(31)29-14-12-28(13-15-29)24-6-1-2-7-24/h3-5,8-11,16-17,24H,1-2,6-7,12-15,19H2 |
| InChIKey | AEAJQLZVWNEKAA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 52.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |