C27H28N3O+ — CID 6862353
(Z,Z)-N-[4-(9H-fluoren-9-yl)piperazin-4-ium-1-yl]-3-(2-methoxyphenyl)prop-2-en-1-imine (PubChem CID 6862353) has the molecular formula C27H28N3O+ and a molecular weight of 410.54 g/mol. Its IUPAC name is (Z,Z)-N-[4-(9H-fluoren-9-yl)piperazin-4-ium-1-yl]-3-(2-methoxyphenyl)prop-2-en-1-imine.
| Compound Name | (Z,Z)-N-[4-(9H-fluoren-9-yl)piperazin-4-ium-1-yl]-3-(2-methoxyphenyl)prop-2-en-1-imine |
|---|---|
| PubChem CID | 6862353 |
| Molecular Formula | C27H28N3O+ |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | (Z,Z)-N-[4-(9H-fluoren-9-yl)piperazin-4-ium-1-yl]-3-(2-methoxyphenyl)prop-2-en-1-imine |
| SMILES | COc1ccccc1/C=C\C=N/N1CC[NH+](C2c3ccccc3-c3ccccc32)CC1 |
| InChI | InChI=1S/C27H27N3O/c1-31-26-15-7-2-9-21(26)10-8-16-28-30-19-17-29(18-20-30)27-24-13-5-3-11-22(24)23-12-4-6-14-25(23)27/h2-16,27H,17-20H2,1H3/p+1/b10-8-,28-16- |
| InChIKey | TZGWMQUPMCHRJQ-KMCRVJJJSA-O |
| XLogP | 3.66 |
| TPSA | 29.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_ene_A(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|