C13H13N3O3 — CID 18280814
1-[(E)-[(E)-3-(2-methoxyphenyl)prop-2-enylidene]amino]imidazolidine-2,4-dione (PubChem CID 18280814) has the molecular formula C13H13N3O3 and a molecular weight of 259.27 g/mol. Its IUPAC name is 1-[(E)-[(E)-3-(2-methoxyphenyl)prop-2-enylidene]amino]imidazolidine-2,4-dione.
| Compound Name | 1-[(E)-[(E)-3-(2-methoxyphenyl)prop-2-enylidene]amino]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 18280814 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 1-[(E)-[(E)-3-(2-methoxyphenyl)prop-2-enylidene]amino]imidazolidine-2,4-dione |
| SMILES | COc1ccccc1/C=C/C=N/N1CC(=O)NC1=O |
| InChI | InChI=1S/C13H13N3O3/c1-19-11-7-3-2-5-10(11)6-4-8-14-16-9-12(17)15-13(16)18/h2-8H,9H2,1H3,(H,15,17,18)/b6-4+,14-8+ |
| InChIKey | KNOUCXHAGJGZJI-SITOFEAGSA-N |
| XLogP | 1.25 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|