C19H18ClN3O5 — CID 9350990
1-[(Z)-[4-[2-(2-chlorophenoxy)ethoxy]-3-methoxyphenyl]methylideneamino]imidazolidine-2,4-dione (PubChem CID 9350990) has the molecular formula C19H18ClN3O5 and a molecular weight of 403.82 g/mol. Its IUPAC name is 1-[(Z)-[4-[2-(2-chlorophenoxy)ethoxy]-3-methoxyphenyl]methylideneamino]imidazolidine-2,4-dione.
| Compound Name | 1-[(Z)-[4-[2-(2-chlorophenoxy)ethoxy]-3-methoxyphenyl]methylideneamino]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9350990 |
| Molecular Formula | C19H18ClN3O5 |
| Molecular Weight | 403.82 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 1-[(Z)-[4-[2-(2-chlorophenoxy)ethoxy]-3-methoxyphenyl]methylideneamino]imidazolidine-2,4-dione |
| SMILES | COc1cc(/C=N\N2CC(=O)NC2=O)ccc1OCCOc1ccccc1Cl |
| InChI | InChI=1S/C19H18ClN3O5/c1-26-17-10-13(11-21-23-12-18(24)22-19(23)25)6-7-16(17)28-9-8-27-15-5-3-2-4-14(15)20/h2-7,10-11H,8-9,12H2,1H3,(H,22,24,25)/b21-11- |
| InChIKey | GSCGBMOAELZTER-NHDPSOOVSA-N |
| XLogP | 2.69 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.82 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|