C20H25NO3 — CID 68626239
1-[2-[[(2S)-1,1-dimethoxy-4-phenylbutan-2-yl]amino]phenyl]ethanone (PubChem CID 68626239) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is 1-[2-[[(2S)-1,1-dimethoxy-4-phenylbutan-2-yl]amino]phenyl]ethanone.
| Compound Name | 1-[2-[[(2S)-1,1-dimethoxy-4-phenylbutan-2-yl]amino]phenyl]ethanone |
|---|---|
| PubChem CID | 68626239 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 1-[2-[[(2S)-1,1-dimethoxy-4-phenylbutan-2-yl]amino]phenyl]ethanone |
| SMILES | COC(OC)[C@H](CCc1ccccc1)Nc1ccccc1C(C)=O |
| InChI | InChI=1S/C20H25NO3/c1-15(22)17-11-7-8-12-18(17)21-19(20(23-2)24-3)14-13-16-9-5-4-6-10-16/h4-12,19-21H,13-14H2,1-3H3/t19-/m0/s1 |
| InChIKey | URCPLQJTGKXYHV-IBGZPJMESA-N |
| XLogP | 3.92 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|