C17H19ClN4OS — CID 68626860
3-piperidin-4-yl-5-thiophen-3-yl-2H-indazole-7-carboxamide;hydrochloride (PubChem CID 68626860) has the molecular formula C17H19ClN4OS and a molecular weight of 362.89 g/mol. Its IUPAC name is 3-piperidin-4-yl-5-thiophen-3-yl-2H-indazole-7-carboxamide;hydrochloride.
| Compound Name | 3-piperidin-4-yl-5-thiophen-3-yl-2H-indazole-7-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 68626860 |
| Molecular Formula | C17H19ClN4OS |
| Molecular Weight | 362.89 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 3-piperidin-4-yl-5-thiophen-3-yl-2H-indazole-7-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)c1cc(-c2ccsc2)cc2c(C3CCNCC3)[nH]nc12 |
| InChI | InChI=1S/C17H18N4OS.ClH/c18-17(22)14-8-12(11-3-6-23-9-11)7-13-15(20-21-16(13)14)10-1-4-19-5-2-10;/h3,6-10,19H,1-2,4-5H2,(H2,18,22)(H,20,21);1H |
| InChIKey | UJERFPMIOWSMOG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.89 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |