C17H14N6O4S — CID 68627160
3-[[4-methyl-5-(5-nitrofuran-2-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-5-(4-methylphenyl)-1,2,4-oxadiazole (PubChem CID 68627160) has the molecular formula C17H14N6O4S and a molecular weight of 398.40 g/mol. Its IUPAC name is 3-[[4-methyl-5-(5-nitrofuran-2-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-5-(4-methylphenyl)-1,2,4-oxadiazole.
| Compound Name | 3-[[4-methyl-5-(5-nitrofuran-2-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-5-(4-methylphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 68627160 |
| Molecular Formula | C17H14N6O4S |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 3-[[4-methyl-5-(5-nitrofuran-2-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-5-(4-methylphenyl)-1,2,4-oxadiazole |
| SMILES | Cc1ccc(-c2nc(CSc3nnc(-c4ccc([N+](=O)[O-])o4)n3C)no2)cc1 |
| InChI | InChI=1S/C17H14N6O4S/c1-10-3-5-11(6-4-10)16-18-13(21-27-16)9-28-17-20-19-15(22(17)2)12-7-8-14(26-12)23(24)25/h3-8H,9H2,1-2H3 |
| InChIKey | GEVBFOGIEPNKMQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 125.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|