C18H24ClN5O5S — CID 68628580
(2S)-2-[[2-chloro-3-(2-oxopyrrolidin-1-yl)phenyl]sulfonylamino]-3-(4-methylpiperazin-1-yl)-3-oxopropanamide (PubChem CID 68628580) has the molecular formula C18H24ClN5O5S and a molecular weight of 457.94 g/mol. Its IUPAC name is (2S)-2-[[2-chloro-3-(2-oxopyrrolidin-1-yl)phenyl]sulfonylamino]-3-(4-methylpiperazin-1-yl)-3-oxopropanamide.
| Compound Name | (2S)-2-[[2-chloro-3-(2-oxopyrrolidin-1-yl)phenyl]sulfonylamino]-3-(4-methylpiperazin-1-yl)-3-oxopropanamide |
|---|---|
| PubChem CID | 68628580 |
| Molecular Formula | C18H24ClN5O5S |
| Molecular Weight | 457.94 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | (2S)-2-[[2-chloro-3-(2-oxopyrrolidin-1-yl)phenyl]sulfonylamino]-3-(4-methylpiperazin-1-yl)-3-oxopropanamide |
| SMILES | CN1CCN(C(=O)[C@@H](NS(=O)(=O)c2cccc(N3CCCC3=O)c2Cl)C(N)=O)CC1 |
| InChI | InChI=1S/C18H24ClN5O5S/c1-22-8-10-23(11-9-22)18(27)16(17(20)26)21-30(28,29)13-5-2-4-12(15(13)19)24-7-3-6-14(24)25/h2,4-5,16,21H,3,6-11H2,1H3,(H2,20,26)/t16-/m0/s1 |
| InChIKey | XLZHHCNYPJUFBD-INIZCTEOSA-N |
| XLogP | -0.63 |
| TPSA | 133.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.94 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|