C20H29N5O6S — CID 70662244
(2S)-2-[[2-methoxy-3-(2-oxopiperidin-1-yl)phenyl]sulfonylamino]-3-(4-methylpiperazin-1-yl)-3-oxopropanamide (PubChem CID 70662244) has the molecular formula C20H29N5O6S and a molecular weight of 467.55 g/mol. Its IUPAC name is (2S)-2-[[2-methoxy-3-(2-oxopiperidin-1-yl)phenyl]sulfonylamino]-3-(4-methylpiperazin-1-yl)-3-oxopropanamide.
| Compound Name | (2S)-2-[[2-methoxy-3-(2-oxopiperidin-1-yl)phenyl]sulfonylamino]-3-(4-methylpiperazin-1-yl)-3-oxopropanamide |
|---|---|
| PubChem CID | 70662244 |
| Molecular Formula | C20H29N5O6S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | (2S)-2-[[2-methoxy-3-(2-oxopiperidin-1-yl)phenyl]sulfonylamino]-3-(4-methylpiperazin-1-yl)-3-oxopropanamide |
| SMILES | COc1c(N2CCCCC2=O)cccc1S(=O)(=O)N[C@@H](C(N)=O)C(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C20H29N5O6S/c1-23-10-12-24(13-11-23)20(28)17(19(21)27)22-32(29,30)15-7-5-6-14(18(15)31-2)25-9-4-3-8-16(25)26/h5-7,17,22H,3-4,8-13H2,1-2H3,(H2,21,27)/t17-/m0/s1 |
| InChIKey | AEPPLEDXQXSFCU-KRWDZBQOSA-N |
| XLogP | -0.88 |
| TPSA | 142.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|