C20H23NO5S — CID 68629751
(2S,3R,4R,5S,6R)-2-[3-(5-ethylthiophen-2-yl)-1H-indol-5-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 68629751) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[3-(5-ethylthiophen-2-yl)-1H-indol-5-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[3-(5-ethylthiophen-2-yl)-1H-indol-5-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 68629751 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[3-(5-ethylthiophen-2-yl)-1H-indol-5-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCc1ccc(-c2c[nH]c3ccc([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cc23)s1 |
| InChI | InChI=1S/C20H23NO5S/c1-2-11-4-6-16(27-11)13-8-21-14-5-3-10(7-12(13)14)20-19(25)18(24)17(23)15(9-22)26-20/h3-8,15,17-25H,2,9H2,1H3/t15-,17-,18+,19-,20+/m1/s1 |
| InChIKey | HVEOSNOAXHAPJM-PKOFMYQESA-N |
| XLogP | 1.97 |
| TPSA | 105.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |