C13H20F3N3OSi — CID 68630704
2-[5-methyl-3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]acetonitrile (PubChem CID 68630704) has the molecular formula C13H20F3N3OSi and a molecular weight of 319.40 g/mol. Its IUPAC name is 2-[5-methyl-3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]acetonitrile.
| Compound Name | 2-[5-methyl-3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]acetonitrile |
|---|---|
| PubChem CID | 68630704 |
| Molecular Formula | C13H20F3N3OSi |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 2-[5-methyl-3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]acetonitrile |
| SMILES | Cc1c(CC#N)c(C(F)(F)F)nn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C13H20F3N3OSi/c1-10-11(5-6-17)12(13(14,15)16)18-19(10)9-20-7-8-21(2,3)4/h5,7-9H2,1-4H3 |
| InChIKey | OFQBETAIFVMVPF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|