C16H24O3 — CID 68632469
2-(10-hydroxydecyl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 68632469) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is 2-(10-hydroxydecyl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-(10-hydroxydecyl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 68632469 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2-(10-hydroxydecyl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C=CC(=O)C(CCCCCCCCCCO)=C1 |
| InChI | InChI=1S/C16H24O3/c17-12-8-6-4-2-1-3-5-7-9-14-13-15(18)10-11-16(14)19/h10-11,13,17H,1-9,12H2 |
| InChIKey | FIFJOBVDJQJKGB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|