C23H20ClN5O3S2 — CID 68632506
imidazo[2,1-b][1,3]thiazol-5-yl N-[[(1S,2S,5R)-3-[5-(3-chlorophenyl)-2-methyl-1,3-thiazole-4-carbonyl]-3-azabicyclo[3.1.0]hexan-2-yl]methyl]carbamate (PubChem CID 68632506) has the molecular formula C23H20ClN5O3S2 and a molecular weight of 514.03 g/mol. Its IUPAC name is imidazo[2,1-b][1,3]thiazol-5-yl N-[[(1S,2S,5R)-3-[5-(3-chlorophenyl)-2-methyl-1,3-thiazole-4-carbonyl]-3-azabicyclo[3.1.0]hexan-2-yl]methyl]carbamate.
| Compound Name | imidazo[2,1-b][1,3]thiazol-5-yl N-[[(1S,2S,5R)-3-[5-(3-chlorophenyl)-2-methyl-1,3-thiazole-4-carbonyl]-3-azabicyclo[3.1.0]hexan-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 68632506 |
| Molecular Formula | C23H20ClN5O3S2 |
| Molecular Weight | 514.03 g/mol |
| Exact Mass | 513.07 |
| IUPAC Name | imidazo[2,1-b][1,3]thiazol-5-yl N-[[(1S,2S,5R)-3-[5-(3-chlorophenyl)-2-methyl-1,3-thiazole-4-carbonyl]-3-azabicyclo[3.1.0]hexan-2-yl]methyl]carbamate |
| SMILES | Cc1nc(C(=O)N2C[C@@H]3C[C@@H]3[C@H]2CNC(=O)Oc2cnc3sccn23)c(-c2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C23H20ClN5O3S2/c1-12-27-19(20(34-12)13-3-2-4-15(24)7-13)21(30)29-11-14-8-16(14)17(29)9-26-23(31)32-18-10-25-22-28(18)5-6-33-22/h2-7,10,14,16-17H,8-9,11H2,1H3,(H,26,31)/t14-,16-,17+/m0/s1 |
| InChIKey | MUMVCPYBPJPGOS-BHYGNILZSA-N |
| XLogP | 4.73 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.03 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |