C18H17FO5 — CID 68633959
methyl (E)-3-[4-fluoro-2-[(3S)-5-oxo-4,10-dioxatricyclo[5.2.1.02,6]decan-3-yl]phenyl]prop-2-enoate (PubChem CID 68633959) has the molecular formula C18H17FO5 and a molecular weight of 332.33 g/mol. Its IUPAC name is methyl (E)-3-[4-fluoro-2-[(3S)-5-oxo-4,10-dioxatricyclo[5.2.1.02,6]decan-3-yl]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-fluoro-2-[(3S)-5-oxo-4,10-dioxatricyclo[5.2.1.02,6]decan-3-yl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 68633959 |
| Molecular Formula | C18H17FO5 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | methyl (E)-3-[4-fluoro-2-[(3S)-5-oxo-4,10-dioxatricyclo[5.2.1.02,6]decan-3-yl]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(F)cc1C1OC(=O)C2C3CCC(O3)C12 |
| InChI | InChI=1S/C18H17FO5/c1-22-14(20)7-3-9-2-4-10(19)8-11(9)17-15-12-5-6-13(23-12)16(15)18(21)24-17/h2-4,7-8,12-13,15-17H,5-6H2,1H3/b7-3+ |
| InChIKey | QKBRRAPJSZKKKP-XVNBXDOJSA-N |
| XLogP | 2.40 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|