C29H41FN2O6 — CID 89306492
methyl (E)-3-[4-fluoro-2-[[3-[[3-hydroxy-1-(octylamino)-1-oxopropan-2-yl]carbamoyl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]phenyl]prop-2-enoate (PubChem CID 89306492) has the molecular formula C29H41FN2O6 and a molecular weight of 532.65 g/mol. Its IUPAC name is methyl (E)-3-[4-fluoro-2-[[3-[[3-hydroxy-1-(octylamino)-1-oxopropan-2-yl]carbamoyl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-fluoro-2-[[3-[[3-hydroxy-1-(octylamino)-1-oxopropan-2-yl]carbamoyl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 89306492 |
| Molecular Formula | C29H41FN2O6 |
| Molecular Weight | 532.65 g/mol |
| Exact Mass | 532.29 |
| IUPAC Name | methyl (E)-3-[4-fluoro-2-[[3-[[3-hydroxy-1-(octylamino)-1-oxopropan-2-yl]carbamoyl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]phenyl]prop-2-enoate |
| SMILES | CCCCCCCCNC(=O)C(CO)NC(=O)C1C2CCC(O2)C1Cc1cc(F)ccc1/C=C/C(=O)OC |
| InChI | InChI=1S/C29H41FN2O6/c1-3-4-5-6-7-8-15-31-28(35)23(18-33)32-29(36)27-22(24-12-13-25(27)38-24)17-20-16-21(30)11-9-19(20)10-14-26(34)37-2/h9-11,14,16,22-25,27,33H,3-8,12-13,15,17-18H2,1-2H3,(H,31,35)(H,32,36)/b14-10+ |
| InChIKey | LYIVLSHSVPFVBD-GXDHUFHOSA-N |
| XLogP | 3.30 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.65 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|