C31H43FN2O6 — CID 89239516
methyl (E)-3-[2-[[3-[4-cyclohexylbutylcarbamoyl(2-hydroxyethyl)carbamoyl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]-4-fluorophenyl]prop-2-enoate (PubChem CID 89239516) has the molecular formula C31H43FN2O6 and a molecular weight of 558.69 g/mol. Its IUPAC name is methyl (E)-3-[2-[[3-[4-cyclohexylbutylcarbamoyl(2-hydroxyethyl)carbamoyl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]-4-fluorophenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[2-[[3-[4-cyclohexylbutylcarbamoyl(2-hydroxyethyl)carbamoyl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]-4-fluorophenyl]prop-2-enoate |
|---|---|
| PubChem CID | 89239516 |
| Molecular Formula | C31H43FN2O6 |
| Molecular Weight | 558.69 g/mol |
| Exact Mass | 558.31 |
| IUPAC Name | methyl (E)-3-[2-[[3-[4-cyclohexylbutylcarbamoyl(2-hydroxyethyl)carbamoyl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]-4-fluorophenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(F)cc1CC1C2CCC(O2)C1C(=O)N(CCO)C(=O)NCCCCC1CCCCC1 |
| InChI | InChI=1S/C31H43FN2O6/c1-39-28(36)15-11-22-10-12-24(32)19-23(22)20-25-26-13-14-27(40-26)29(25)30(37)34(17-18-35)31(38)33-16-6-5-9-21-7-3-2-4-8-21/h10-12,15,19,21,25-27,29,35H,2-9,13-14,16-18,20H2,1H3,(H,33,38)/b15-11+ |
| InChIKey | OCLJKJPKCZMPJC-RVDMUPIBSA-N |
| XLogP | 4.63 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.69 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|