C33H45FN2O7 — CID 46940294
2,3-dihydroxypropyl 3-[2-[[(1R,2R,3S,4R)-3-[4-(4-cyclohexylbutylcarbamoyl)-1,3-oxazol-2-yl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]-4-fluorophenyl]propanoate (PubChem CID 46940294) has the molecular formula C33H45FN2O7 and a molecular weight of 600.73 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 3-[2-[[(1R,2R,3S,4R)-3-[4-(4-cyclohexylbutylcarbamoyl)-1,3-oxazol-2-yl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]-4-fluorophenyl]propanoate.
| Compound Name | 2,3-dihydroxypropyl 3-[2-[[(1R,2R,3S,4R)-3-[4-(4-cyclohexylbutylcarbamoyl)-1,3-oxazol-2-yl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]-4-fluorophenyl]propanoate |
|---|---|
| PubChem CID | 46940294 |
| Molecular Formula | C33H45FN2O7 |
| Molecular Weight | 600.73 g/mol |
| Exact Mass | 600.32 |
| IUPAC Name | 2,3-dihydroxypropyl 3-[2-[[(1R,2R,3S,4R)-3-[4-(4-cyclohexylbutylcarbamoyl)-1,3-oxazol-2-yl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]-4-fluorophenyl]propanoate |
| SMILES | O=C(CCc1ccc(F)cc1C[C@@H]1[C@H](c2nc(C(=O)NCCCCC3CCCCC3)co2)[C@H]2CC[C@H]1O2)OCC(O)CO |
| InChI | InChI=1S/C33H45FN2O7/c34-24-11-9-22(10-14-30(39)41-19-25(38)18-37)23(16-24)17-26-28-12-13-29(43-28)31(26)33-36-27(20-42-33)32(40)35-15-5-4-8-21-6-2-1-3-7-21/h9,11,16,20-21,25-26,28-29,31,37-38H,1-8,10,12-15,17-19H2,(H,35,40)/t25?,26-,28+,29+,31-/m0/s1 |
| InChIKey | PYEJYJLSPUDWDB-SFRLJXAOSA-N |
| XLogP | 4.63 |
| TPSA | 131.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.73 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|