C31H42N2O4S — CID 10370015
methyl 3-[2-[[(1S,2R,3S,4R)-3-[4-(4-cyclohexylbutylcarbamothioyl)-1,3-oxazol-2-yl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]phenyl]propanoate (PubChem CID 10370015) has the molecular formula C31H42N2O4S and a molecular weight of 538.75 g/mol. Its IUPAC name is methyl 3-[2-[[(1S,2R,3S,4R)-3-[4-(4-cyclohexylbutylcarbamothioyl)-1,3-oxazol-2-yl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]phenyl]propanoate.
| Compound Name | methyl 3-[2-[[(1S,2R,3S,4R)-3-[4-(4-cyclohexylbutylcarbamothioyl)-1,3-oxazol-2-yl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]phenyl]propanoate |
|---|---|
| PubChem CID | 10370015 |
| Molecular Formula | C31H42N2O4S |
| Molecular Weight | 538.75 g/mol |
| Exact Mass | 538.29 |
| IUPAC Name | methyl 3-[2-[[(1S,2R,3S,4R)-3-[4-(4-cyclohexylbutylcarbamothioyl)-1,3-oxazol-2-yl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccccc1C[C@@H]1[C@H](c2nc(C(=S)NCCCCC3CCCCC3)co2)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C31H42N2O4S/c1-35-28(34)17-14-22-12-5-6-13-23(22)19-24-26-15-16-27(37-26)29(24)30-33-25(20-36-30)31(38)32-18-8-7-11-21-9-3-2-4-10-21/h5-6,12-13,20-21,24,26-27,29H,2-4,7-11,14-19H2,1H3,(H,32,38)/t24-,26-,27+,29-/m0/s1 |
| InChIKey | HFCUKDKGCVHJGU-BUXVXPHYSA-N |
| XLogP | 6.30 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.75 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|