C30H42N2O5 — CID 10152464
3-[2-[[(1S,2R,3S,4R)-3-[4-(7,7-dimethyloctylcarbamoyl)-1,3-oxazol-2-yl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]phenyl]propanoic acid (PubChem CID 10152464) has the molecular formula C30H42N2O5 and a molecular weight of 510.68 g/mol. Its IUPAC name is 3-[2-[[(1S,2R,3S,4R)-3-[4-(7,7-dimethyloctylcarbamoyl)-1,3-oxazol-2-yl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]phenyl]propanoic acid.
| Compound Name | 3-[2-[[(1S,2R,3S,4R)-3-[4-(7,7-dimethyloctylcarbamoyl)-1,3-oxazol-2-yl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 10152464 |
| Molecular Formula | C30H42N2O5 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.31 |
| IUPAC Name | 3-[2-[[(1S,2R,3S,4R)-3-[4-(7,7-dimethyloctylcarbamoyl)-1,3-oxazol-2-yl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]phenyl]propanoic acid |
| SMILES | CC(C)(C)CCCCCCNC(=O)c1coc([C@H]2[C@@H](Cc3ccccc3CCC(=O)O)[C@@H]3CC[C@H]2O3)n1 |
| InChI | InChI=1S/C30H42N2O5/c1-30(2,3)16-8-4-5-9-17-31-28(35)23-19-36-29(32-23)27-22(24-13-14-25(27)37-24)18-21-11-7-6-10-20(21)12-15-26(33)34/h6-7,10-11,19,22,24-25,27H,4-5,8-9,12-18H2,1-3H3,(H,31,35)(H,33,34)/t22-,24-,25+,27-/m0/s1 |
| InChIKey | HPWZLKOTRHSKTD-UQBYDPJISA-N |
| XLogP | 5.92 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|