C30H42N2O5 — CID 175749539
2-[2-[[3-[4-(7,7-dimethyloctylcarbamoyl)-1,3-oxazol-2-yl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]phenyl]propanoic acid (PubChem CID 175749539) has the molecular formula C30H42N2O5 and a molecular weight of 510.68 g/mol. Its IUPAC name is 2-[2-[[3-[4-(7,7-dimethyloctylcarbamoyl)-1,3-oxazol-2-yl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]phenyl]propanoic acid.
| Compound Name | 2-[2-[[3-[4-(7,7-dimethyloctylcarbamoyl)-1,3-oxazol-2-yl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 175749539 |
| Molecular Formula | C30H42N2O5 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.31 |
| IUPAC Name | 2-[2-[[3-[4-(7,7-dimethyloctylcarbamoyl)-1,3-oxazol-2-yl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]phenyl]propanoic acid |
| SMILES | CC(C(=O)O)c1ccccc1CC1C2CCC(O2)C1c1nc(C(=O)NCCCCCCC(C)(C)C)co1 |
| InChI | InChI=1S/C30H42N2O5/c1-19(29(34)35)21-12-8-7-11-20(21)17-22-24-13-14-25(37-24)26(22)28-32-23(18-36-28)27(33)31-16-10-6-5-9-15-30(2,3)4/h7-8,11-12,18-19,22,24-26H,5-6,9-10,13-17H2,1-4H3,(H,31,33)(H,34,35) |
| InChIKey | SFHKDUUBGRKTIS-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|