C26H31ClN2O5 — CID 67820575
(Z)-6-[(1S,2R,3S,4R)-3-[4-[4-(4-chlorophenyl)butylcarbamoyl]-1,3-oxazol-2-yl]-7-oxabicyclo[2.2.1]heptan-2-yl]hex-4-enoic acid (PubChem CID 67820575) has the molecular formula C26H31ClN2O5 and a molecular weight of 487.00 g/mol. Its IUPAC name is (Z)-6-[(1S,2R,3S,4R)-3-[4-[4-(4-chlorophenyl)butylcarbamoyl]-1,3-oxazol-2-yl]-7-oxabicyclo[2.2.1]heptan-2-yl]hex-4-enoic acid.
| Compound Name | (Z)-6-[(1S,2R,3S,4R)-3-[4-[4-(4-chlorophenyl)butylcarbamoyl]-1,3-oxazol-2-yl]-7-oxabicyclo[2.2.1]heptan-2-yl]hex-4-enoic acid |
|---|---|
| PubChem CID | 67820575 |
| Molecular Formula | C26H31ClN2O5 |
| Molecular Weight | 487.00 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | (Z)-6-[(1S,2R,3S,4R)-3-[4-[4-(4-chlorophenyl)butylcarbamoyl]-1,3-oxazol-2-yl]-7-oxabicyclo[2.2.1]heptan-2-yl]hex-4-enoic acid |
| SMILES | O=C(O)CC/C=C\C[C@@H]1[C@H](c2nc(C(=O)NCCCCc3ccc(Cl)cc3)co2)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C26H31ClN2O5/c27-18-11-9-17(10-12-18)6-4-5-15-28-25(32)20-16-33-26(29-20)24-19(21-13-14-22(24)34-21)7-2-1-3-8-23(30)31/h1-2,9-12,16,19,21-22,24H,3-8,13-15H2,(H,28,32)(H,30,31)/b2-1-/t19-,21-,22+,24-/m0/s1 |
| InChIKey | BDXLLBXEUNHULT-IFIZWSKGSA-N |
| XLogP | 5.15 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.00 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|