C26H39N3O4 — CID 67804541
(Z)-6-[(1S,2R,3R,4R)-3-[5-(4-cyclohexylbutylcarbamoyl)-1H-imidazol-2-yl]-7-oxabicyclo[2.2.1]heptan-2-yl]hex-4-enoic acid (PubChem CID 67804541) has the molecular formula C26H39N3O4 and a molecular weight of 457.62 g/mol. Its IUPAC name is (Z)-6-[(1S,2R,3R,4R)-3-[5-(4-cyclohexylbutylcarbamoyl)-1H-imidazol-2-yl]-7-oxabicyclo[2.2.1]heptan-2-yl]hex-4-enoic acid.
| Compound Name | (Z)-6-[(1S,2R,3R,4R)-3-[5-(4-cyclohexylbutylcarbamoyl)-1H-imidazol-2-yl]-7-oxabicyclo[2.2.1]heptan-2-yl]hex-4-enoic acid |
|---|---|
| PubChem CID | 67804541 |
| Molecular Formula | C26H39N3O4 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.29 |
| IUPAC Name | (Z)-6-[(1S,2R,3R,4R)-3-[5-(4-cyclohexylbutylcarbamoyl)-1H-imidazol-2-yl]-7-oxabicyclo[2.2.1]heptan-2-yl]hex-4-enoic acid |
| SMILES | O=C(O)CC/C=C\C[C@@H]1[C@H](c2ncc(C(=O)NCCCCC3CCCCC3)[nH]2)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C26H39N3O4/c30-23(31)13-6-2-5-12-19-21-14-15-22(33-21)24(19)25-28-17-20(29-25)26(32)27-16-8-7-11-18-9-3-1-4-10-18/h2,5,17-19,21-22,24H,1,3-4,6-16H2,(H,27,32)(H,28,29)(H,30,31)/b5-2-/t19-,21-,22+,24-/m0/s1 |
| InChIKey | SCHVVLZZJCECCK-SCWIIZIJSA-N |
| XLogP | 4.96 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|