C24H27ClN2O5 — CID 57209333
6-[(1S,2R,3S,4R)-3-[4-[2-(4-chlorophenyl)ethylcarbamoyl]-1,3-oxazol-2-yl]-7-oxabicyclo[2.2.1]heptan-2-yl]hex-4-enoic acid (PubChem CID 57209333) has the molecular formula C24H27ClN2O5 and a molecular weight of 458.94 g/mol. Its IUPAC name is 6-[(1S,2R,3S,4R)-3-[4-[2-(4-chlorophenyl)ethylcarbamoyl]-1,3-oxazol-2-yl]-7-oxabicyclo[2.2.1]heptan-2-yl]hex-4-enoic acid.
| Compound Name | 6-[(1S,2R,3S,4R)-3-[4-[2-(4-chlorophenyl)ethylcarbamoyl]-1,3-oxazol-2-yl]-7-oxabicyclo[2.2.1]heptan-2-yl]hex-4-enoic acid |
|---|---|
| PubChem CID | 57209333 |
| Molecular Formula | C24H27ClN2O5 |
| Molecular Weight | 458.94 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 6-[(1S,2R,3S,4R)-3-[4-[2-(4-chlorophenyl)ethylcarbamoyl]-1,3-oxazol-2-yl]-7-oxabicyclo[2.2.1]heptan-2-yl]hex-4-enoic acid |
| SMILES | O=C(O)CCC=CC[C@@H]1[C@H](c2nc(C(=O)NCCc3ccc(Cl)cc3)co2)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C24H27ClN2O5/c25-16-8-6-15(7-9-16)12-13-26-23(30)18-14-31-24(27-18)22-17(19-10-11-20(22)32-19)4-2-1-3-5-21(28)29/h1-2,6-9,14,17,19-20,22H,3-5,10-13H2,(H,26,30)(H,28,29)/t17-,19-,20+,22-/m0/s1 |
| InChIKey | BOBHARQDVNEFRL-KMQSCTNJSA-N |
| XLogP | 4.37 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.94 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|