C26H38N6O3 — CID 57310195
N-(4-cyclohexylbutyl)-2-[(1R,2S,3R,4S)-3-[5-(2H-tetrazol-5-yl)pent-2-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]-1,3-oxazole-4-carboxamide (PubChem CID 57310195) has the molecular formula C26H38N6O3 and a molecular weight of 482.63 g/mol. Its IUPAC name is N-(4-cyclohexylbutyl)-2-[(1R,2S,3R,4S)-3-[5-(2H-tetrazol-5-yl)pent-2-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-(4-cyclohexylbutyl)-2-[(1R,2S,3R,4S)-3-[5-(2H-tetrazol-5-yl)pent-2-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 57310195 |
| Molecular Formula | C26H38N6O3 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.30 |
| IUPAC Name | N-(4-cyclohexylbutyl)-2-[(1R,2S,3R,4S)-3-[5-(2H-tetrazol-5-yl)pent-2-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NCCCCC1CCCCC1)c1coc([C@H]2[C@@H](CC=CCCc3nn[nH]n3)[C@@H]3CC[C@H]2O3)n1 |
| InChI | InChI=1S/C26H38N6O3/c33-25(27-16-8-7-11-18-9-3-1-4-10-18)20-17-34-26(28-20)24-19(21-14-15-22(24)35-21)12-5-2-6-13-23-29-31-32-30-23/h2,5,17-19,21-22,24H,1,3-4,6-16H2,(H,27,33)(H,29,30,31,32)/t19-,21-,22+,24-/m0/s1 |
| InChIKey | RXPJBARRZYUOAF-KZDDHRSZSA-N |
| XLogP | 4.51 |
| TPSA | 118.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|