C27H41N3O6S — CID 142702576
N-(4-cyclohexylbutyl)-2-[3-[[(E)-hex-4-enoyl]amino]-4-methylsulfonyl-7-oxabicyclo[2.2.1]heptan-2-yl]-1,3-oxazole-4-carboxamide (PubChem CID 142702576) has the molecular formula C27H41N3O6S and a molecular weight of 535.71 g/mol. Its IUPAC name is N-(4-cyclohexylbutyl)-2-[3-[[(E)-hex-4-enoyl]amino]-4-methylsulfonyl-7-oxabicyclo[2.2.1]heptan-2-yl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-(4-cyclohexylbutyl)-2-[3-[[(E)-hex-4-enoyl]amino]-4-methylsulfonyl-7-oxabicyclo[2.2.1]heptan-2-yl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 142702576 |
| Molecular Formula | C27H41N3O6S |
| Molecular Weight | 535.71 g/mol |
| Exact Mass | 535.27 |
| IUPAC Name | N-(4-cyclohexylbutyl)-2-[3-[[(E)-hex-4-enoyl]amino]-4-methylsulfonyl-7-oxabicyclo[2.2.1]heptan-2-yl]-1,3-oxazole-4-carboxamide |
| SMILES | C/C=C/CCC(=O)NC1C(c2nc(C(=O)NCCCCC3CCCCC3)co2)C2CCC1(S(C)(=O)=O)O2 |
| InChI | InChI=1S/C27H41N3O6S/c1-3-4-6-14-22(31)30-24-23(21-15-16-27(24,36-21)37(2,33)34)26-29-20(18-35-26)25(32)28-17-10-9-13-19-11-7-5-8-12-19/h3-4,18-19,21,23-24H,5-17H2,1-2H3,(H,28,32)(H,30,31)/b4-3+ |
| InChIKey | OFZUGAKBWLOWQJ-ONEGZZNKSA-N |
| XLogP | 4.01 |
| TPSA | 127.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.71 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|