C30H43N3O5 — CID 70896382
4-[2-[[2-[4-(4-cyclohexylbutylcarbamoyl)-1,3-oxazol-2-yl]pyrrolidin-1-yl]methyl]-4-methoxyphenyl]butanoic acid (PubChem CID 70896382) has the molecular formula C30H43N3O5 and a molecular weight of 525.69 g/mol. Its IUPAC name is 4-[2-[[2-[4-(4-cyclohexylbutylcarbamoyl)-1,3-oxazol-2-yl]pyrrolidin-1-yl]methyl]-4-methoxyphenyl]butanoic acid.
| Compound Name | 4-[2-[[2-[4-(4-cyclohexylbutylcarbamoyl)-1,3-oxazol-2-yl]pyrrolidin-1-yl]methyl]-4-methoxyphenyl]butanoic acid |
|---|---|
| PubChem CID | 70896382 |
| Molecular Formula | C30H43N3O5 |
| Molecular Weight | 525.69 g/mol |
| Exact Mass | 525.32 |
| IUPAC Name | 4-[2-[[2-[4-(4-cyclohexylbutylcarbamoyl)-1,3-oxazol-2-yl]pyrrolidin-1-yl]methyl]-4-methoxyphenyl]butanoic acid |
| SMILES | COc1ccc(CCCC(=O)O)c(CN2CCCC2c2nc(C(=O)NCCCCC3CCCCC3)co2)c1 |
| InChI | InChI=1S/C30H43N3O5/c1-37-25-16-15-23(12-7-14-28(34)35)24(19-25)20-33-18-8-13-27(33)30-32-26(21-38-30)29(36)31-17-6-5-11-22-9-3-2-4-10-22/h15-16,19,21-22,27H,2-14,17-18,20H2,1H3,(H,31,36)(H,34,35) |
| InChIKey | IUOVAJRYUFPDSI-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 104.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.69 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|