C30H42N2O4 — CID 139618312
methyl 3-[2-[[(1S,2S)-2-[4-(4-cyclohexylbutylcarbamoyl)-1,3-oxazol-2-yl]cyclopentyl]methyl]phenyl]propanoate (PubChem CID 139618312) has the molecular formula C30H42N2O4 and a molecular weight of 494.68 g/mol. Its IUPAC name is methyl 3-[2-[[(1S,2S)-2-[4-(4-cyclohexylbutylcarbamoyl)-1,3-oxazol-2-yl]cyclopentyl]methyl]phenyl]propanoate.
| Compound Name | methyl 3-[2-[[(1S,2S)-2-[4-(4-cyclohexylbutylcarbamoyl)-1,3-oxazol-2-yl]cyclopentyl]methyl]phenyl]propanoate |
|---|---|
| PubChem CID | 139618312 |
| Molecular Formula | C30H42N2O4 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | methyl 3-[2-[[(1S,2S)-2-[4-(4-cyclohexylbutylcarbamoyl)-1,3-oxazol-2-yl]cyclopentyl]methyl]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccccc1C[C@@H]1CCC[C@@H]1c1nc(C(=O)NCCCCC2CCCCC2)co1 |
| InChI | InChI=1S/C30H42N2O4/c1-35-28(33)18-17-23-13-5-6-14-24(23)20-25-15-9-16-26(25)30-32-27(21-36-30)29(34)31-19-8-7-12-22-10-3-2-4-11-22/h5-6,13-14,21-22,25-26H,2-4,7-12,15-20H2,1H3,(H,31,34)/t25-,26-/m0/s1 |
| InChIKey | VSIBKJKAQKKGKY-UIOOFZCWSA-N |
| XLogP | 6.39 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|