C31H43N3O6S — CID 10438303
N-(4-cyclohexylbutyl)-2-[(1R,2S,3R,4S)-3-[[2-[3-(methanesulfonamido)-3-oxopropyl]phenyl]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]-1,3-oxazole-4-carboxamide (PubChem CID 10438303) has the molecular formula C31H43N3O6S and a molecular weight of 585.77 g/mol. Its IUPAC name is N-(4-cyclohexylbutyl)-2-[(1R,2S,3R,4S)-3-[[2-[3-(methanesulfonamido)-3-oxopropyl]phenyl]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-(4-cyclohexylbutyl)-2-[(1R,2S,3R,4S)-3-[[2-[3-(methanesulfonamido)-3-oxopropyl]phenyl]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 10438303 |
| Molecular Formula | C31H43N3O6S |
| Molecular Weight | 585.77 g/mol |
| Exact Mass | 585.29 |
| IUPAC Name | N-(4-cyclohexylbutyl)-2-[(1R,2S,3R,4S)-3-[[2-[3-(methanesulfonamido)-3-oxopropyl]phenyl]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]-1,3-oxazole-4-carboxamide |
| SMILES | CS(=O)(=O)NC(=O)CCc1ccccc1C[C@@H]1[C@H](c2nc(C(=O)NCCCCC3CCCCC3)co2)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C31H43N3O6S/c1-41(37,38)34-28(35)17-14-22-12-5-6-13-23(22)19-24-26-15-16-27(40-26)29(24)31-33-25(20-39-31)30(36)32-18-8-7-11-21-9-3-2-4-10-21/h5-6,12-13,20-21,24,26-27,29H,2-4,7-11,14-19H2,1H3,(H,32,36)(H,34,35)/t24-,26-,27+,29-/m0/s1 |
| InChIKey | GUQZFAORYXDJNW-BUXVXPHYSA-N |
| XLogP | 4.67 |
| TPSA | 127.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.77 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|