C27H35FN2O3 — CID 123536483
N-(4-cyclohexylbutyl)-2-[(2R)-3-[(3-fluorophenyl)methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]-1,3-oxazole-4-carboxamide (PubChem CID 123536483) has the molecular formula C27H35FN2O3 and a molecular weight of 454.59 g/mol. Its IUPAC name is N-(4-cyclohexylbutyl)-2-[(2R)-3-[(3-fluorophenyl)methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-(4-cyclohexylbutyl)-2-[(2R)-3-[(3-fluorophenyl)methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 123536483 |
| Molecular Formula | C27H35FN2O3 |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | N-(4-cyclohexylbutyl)-2-[(2R)-3-[(3-fluorophenyl)methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NCCCCC1CCCCC1)c1coc([C@H]2C3CCC(O3)C2Cc2cccc(F)c2)n1 |
| InChI | InChI=1S/C27H35FN2O3/c28-20-11-6-10-19(15-20)16-21-23-12-13-24(33-23)25(21)27-30-22(17-32-27)26(31)29-14-5-4-9-18-7-2-1-3-8-18/h6,10-11,15,17-18,21,23-25H,1-5,7-9,12-14,16H2,(H,29,31)/t21?,23?,24?,25-/m1/s1 |
| InChIKey | KSRAHLQNMOWDPB-KCIGQYEDSA-N |
| XLogP | 5.80 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|