C25H31F2N3O3 — CID 70797832
N-(3-cyclohexylpropyl)-2-[(1R,2R,3S,4S)-3-[(3,5-difluorophenyl)methyl]-5-oxabicyclo[2.1.1]hexan-2-yl]-1,3-oxazole-4-carbohydrazide (PubChem CID 70797832) has the molecular formula C25H31F2N3O3 and a molecular weight of 459.54 g/mol. Its IUPAC name is N-(3-cyclohexylpropyl)-2-[(1R,2R,3S,4S)-3-[(3,5-difluorophenyl)methyl]-5-oxabicyclo[2.1.1]hexan-2-yl]-1,3-oxazole-4-carbohydrazide.
| Compound Name | N-(3-cyclohexylpropyl)-2-[(1R,2R,3S,4S)-3-[(3,5-difluorophenyl)methyl]-5-oxabicyclo[2.1.1]hexan-2-yl]-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 70797832 |
| Molecular Formula | C25H31F2N3O3 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | N-(3-cyclohexylpropyl)-2-[(1R,2R,3S,4S)-3-[(3,5-difluorophenyl)methyl]-5-oxabicyclo[2.1.1]hexan-2-yl]-1,3-oxazole-4-carbohydrazide |
| SMILES | NN(CCCC1CCCCC1)C(=O)c1coc([C@@H]2[C@H](Cc3cc(F)cc(F)c3)[C@@H]3C[C@H]2O3)n1 |
| InChI | InChI=1S/C25H31F2N3O3/c26-17-9-16(10-18(27)12-17)11-19-21-13-22(33-21)23(19)24-29-20(14-32-24)25(31)30(28)8-4-7-15-5-2-1-3-6-15/h9-10,12,14-15,19,21-23H,1-8,11,13,28H2/t19-,21+,22-,23-/m1/s1 |
| InChIKey | IUZANCHDRYEBJT-CWKRKGSWSA-N |
| XLogP | 4.74 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|