C31H39FN2O5 — CID 66824034
methyl (E)-3-[3-[[4-(4-cyclohexylbutylcarbamoyl)-1,3-oxazol-2-yl]-[(2R)-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]-4-fluorophenyl]prop-2-enoate (PubChem CID 66824034) has the molecular formula C31H39FN2O5 and a molecular weight of 538.66 g/mol. Its IUPAC name is methyl (E)-3-[3-[[4-(4-cyclohexylbutylcarbamoyl)-1,3-oxazol-2-yl]-[(2R)-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]-4-fluorophenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-[[4-(4-cyclohexylbutylcarbamoyl)-1,3-oxazol-2-yl]-[(2R)-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]-4-fluorophenyl]prop-2-enoate |
|---|---|
| PubChem CID | 66824034 |
| Molecular Formula | C31H39FN2O5 |
| Molecular Weight | 538.66 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | methyl (E)-3-[3-[[4-(4-cyclohexylbutylcarbamoyl)-1,3-oxazol-2-yl]-[(2R)-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]-4-fluorophenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(F)c(C(c2nc(C(=O)NCCCCC3CCCCC3)co2)[C@H]2CC3CCC2O3)c1 |
| InChI | InChI=1S/C31H39FN2O5/c1-37-28(35)15-11-21-10-13-25(32)23(17-21)29(24-18-22-12-14-27(24)39-22)31-34-26(19-38-31)30(36)33-16-6-5-9-20-7-3-2-4-8-20/h10-11,13,15,17,19-20,22,24,27,29H,2-9,12,14,16,18H2,1H3,(H,33,36)/b15-11+/t22?,24-,27?,29?/m0/s1 |
| InChIKey | IBUVCQCTNVYHIP-YZYGHUOFSA-N |
| XLogP | 6.18 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.66 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|