C11H17F3N2O4 — CID 68634217
N'-cyclohexyl-N'-methyloxamide;2,2,2-trifluoroacetic acid (PubChem CID 68634217) has the molecular formula C11H17F3N2O4 and a molecular weight of 298.26 g/mol. Its IUPAC name is N'-cyclohexyl-N'-methyloxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N'-cyclohexyl-N'-methyloxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68634217 |
| Molecular Formula | C11H17F3N2O4 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | N'-cyclohexyl-N'-methyloxamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C(=O)C(N)=O)C1CCCCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C9H16N2O2.C2HF3O2/c1-11(9(13)8(10)12)7-5-3-2-4-6-7;3-2(4,5)1(6)7/h7H,2-6H2,1H3,(H2,10,12);(H,6,7) |
| InChIKey | OBMRUZDNGANKAT-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|