C27H34F3N3O5S — CID 68636542
N-[2-(benzenesulfonylmethyl)-4-[methyl(propan-2-yl)amino]cyclohexyl]-N'-[3-(trifluoromethoxy)phenyl]propanediamide (PubChem CID 68636542) has the molecular formula C27H34F3N3O5S and a molecular weight of 569.65 g/mol. Its IUPAC name is N-[2-(benzenesulfonylmethyl)-4-[methyl(propan-2-yl)amino]cyclohexyl]-N'-[3-(trifluoromethoxy)phenyl]propanediamide.
| Compound Name | N-[2-(benzenesulfonylmethyl)-4-[methyl(propan-2-yl)amino]cyclohexyl]-N'-[3-(trifluoromethoxy)phenyl]propanediamide |
|---|---|
| PubChem CID | 68636542 |
| Molecular Formula | C27H34F3N3O5S |
| Molecular Weight | 569.65 g/mol |
| Exact Mass | 569.22 |
| IUPAC Name | N-[2-(benzenesulfonylmethyl)-4-[methyl(propan-2-yl)amino]cyclohexyl]-N'-[3-(trifluoromethoxy)phenyl]propanediamide |
| SMILES | CC(C)N(C)C1CCC(NC(=O)CC(=O)Nc2cccc(OC(F)(F)F)c2)C(CS(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C27H34F3N3O5S/c1-18(2)33(3)21-12-13-24(19(14-21)17-39(36,37)23-10-5-4-6-11-23)32-26(35)16-25(34)31-20-8-7-9-22(15-20)38-27(28,29)30/h4-11,15,18-19,21,24H,12-14,16-17H2,1-3H3,(H,31,34)(H,32,35) |
| InChIKey | BLAIRDCQTMGXDG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.65 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|