C27H35F3N4O4S — CID 68637442
N'-[2-amino-5-(trifluoromethyl)phenyl]-N-[2-(benzenesulfonylmethyl)-4-[methyl(propan-2-yl)amino]cyclohexyl]propanediamide (PubChem CID 68637442) has the molecular formula C27H35F3N4O4S and a molecular weight of 568.66 g/mol. Its IUPAC name is N'-[2-amino-5-(trifluoromethyl)phenyl]-N-[2-(benzenesulfonylmethyl)-4-[methyl(propan-2-yl)amino]cyclohexyl]propanediamide.
| Compound Name | N'-[2-amino-5-(trifluoromethyl)phenyl]-N-[2-(benzenesulfonylmethyl)-4-[methyl(propan-2-yl)amino]cyclohexyl]propanediamide |
|---|---|
| PubChem CID | 68637442 |
| Molecular Formula | C27H35F3N4O4S |
| Molecular Weight | 568.66 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | N'-[2-amino-5-(trifluoromethyl)phenyl]-N-[2-(benzenesulfonylmethyl)-4-[methyl(propan-2-yl)amino]cyclohexyl]propanediamide |
| SMILES | CC(C)N(C)C1CCC(NC(=O)CC(=O)Nc2cc(C(F)(F)F)ccc2N)C(CS(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C27H35F3N4O4S/c1-17(2)34(3)20-10-12-23(18(13-20)16-39(37,38)21-7-5-4-6-8-21)32-25(35)15-26(36)33-24-14-19(27(28,29)30)9-11-22(24)31/h4-9,11,14,17-18,20,23H,10,12-13,15-16,31H2,1-3H3,(H,32,35)(H,33,36) |
| InChIKey | QVCPTZKQISKWLI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.66 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|