C12H20N2 — CID 68636836
2-(4-methylpentan-2-yl)benzene-1,3-diamine (PubChem CID 68636836) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 2-(4-methylpentan-2-yl)benzene-1,3-diamine.
| Compound Name | 2-(4-methylpentan-2-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 68636836 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 2-(4-methylpentan-2-yl)benzene-1,3-diamine |
| SMILES | CC(C)CC(C)c1c(N)cccc1N |
| InChI | InChI=1S/C12H20N2/c1-8(2)7-9(3)12-10(13)5-4-6-11(12)14/h4-6,8-9H,7,13-14H2,1-3H3 |
| InChIKey | IZYXXJWDNUVXTD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|