C34H41N3O3 — CID 68638695
2-[4,4-diethyl-3-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-[2,6-di(propan-2-yl)phenyl]-2-phenylacetamide (PubChem CID 68638695) has the molecular formula C34H41N3O3 and a molecular weight of 539.72 g/mol. Its IUPAC name is 2-[4,4-diethyl-3-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-[2,6-di(propan-2-yl)phenyl]-2-phenylacetamide.
| Compound Name | 2-[4,4-diethyl-3-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-[2,6-di(propan-2-yl)phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 68638695 |
| Molecular Formula | C34H41N3O3 |
| Molecular Weight | 539.72 g/mol |
| Exact Mass | 539.31 |
| IUPAC Name | 2-[4,4-diethyl-3-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-[2,6-di(propan-2-yl)phenyl]-2-phenylacetamide |
| SMILES | CCC1(CC)C(=O)N(C(C(=O)Nc2c(C(C)C)cccc2C(C)C)c2ccccc2)C(=O)N1c1ccc(C)cc1 |
| InChI | InChI=1S/C34H41N3O3/c1-8-34(9-2)32(39)36(33(40)37(34)26-20-18-24(7)19-21-26)30(25-14-11-10-12-15-25)31(38)35-29-27(22(3)4)16-13-17-28(29)23(5)6/h10-23,30H,8-9H2,1-7H3,(H,35,38) |
| InChIKey | MOPQBJTVTGKUJD-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.72 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|