C18H21ClN2O2S — CID 68641753
1-[1-(4-chlorophenyl)cyclohexyl]-2-[(5-methyl-1H-imidazol-2-yl)sulfinyl]ethanone (PubChem CID 68641753) has the molecular formula C18H21ClN2O2S and a molecular weight of 364.90 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)cyclohexyl]-2-[(5-methyl-1H-imidazol-2-yl)sulfinyl]ethanone.
| Compound Name | 1-[1-(4-chlorophenyl)cyclohexyl]-2-[(5-methyl-1H-imidazol-2-yl)sulfinyl]ethanone |
|---|---|
| PubChem CID | 68641753 |
| Molecular Formula | C18H21ClN2O2S |
| Molecular Weight | 364.90 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 1-[1-(4-chlorophenyl)cyclohexyl]-2-[(5-methyl-1H-imidazol-2-yl)sulfinyl]ethanone |
| SMILES | Cc1cnc(S(=O)CC(=O)C2(c3ccc(Cl)cc3)CCCCC2)[nH]1 |
| InChI | InChI=1S/C18H21ClN2O2S/c1-13-11-20-17(21-13)24(23)12-16(22)18(9-3-2-4-10-18)14-5-7-15(19)8-6-14/h5-8,11H,2-4,9-10,12H2,1H3,(H,20,21) |
| InChIKey | BWGRYMOLXFZNSD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.90 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |