C21H17FN4 — CID 68642170
2-[1-[(2-fluorophenyl)methyl]-5-(4-methylphenyl)pyrazol-3-yl]pyrimidine (PubChem CID 68642170) has the molecular formula C21H17FN4 and a molecular weight of 344.39 g/mol. Its IUPAC name is 2-[1-[(2-fluorophenyl)methyl]-5-(4-methylphenyl)pyrazol-3-yl]pyrimidine.
| Compound Name | 2-[1-[(2-fluorophenyl)methyl]-5-(4-methylphenyl)pyrazol-3-yl]pyrimidine |
|---|---|
| PubChem CID | 68642170 |
| Molecular Formula | C21H17FN4 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 2-[1-[(2-fluorophenyl)methyl]-5-(4-methylphenyl)pyrazol-3-yl]pyrimidine |
| SMILES | Cc1ccc(-c2cc(-c3ncccn3)nn2Cc2ccccc2F)cc1 |
| InChI | InChI=1S/C21H17FN4/c1-15-7-9-16(10-8-15)20-13-19(21-23-11-4-12-24-21)25-26(20)14-17-5-2-3-6-18(17)22/h2-13H,14H2,1H3 |
| InChIKey | WMMTXAOMTDEAJK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |