C23H26N6O5S — CID 68643585
5-[1-[1-(4-methoxy-2-methylphenyl)-6-methyl-2,3-dihydropyrrolo[2,3-b]pyridin-4-yl]pyrazol-3-yl]-2-methyl-1,1-dioxo-1,2,5-thiadiazolidin-2-ium-2-carboxylate (PubChem CID 68643585) has the molecular formula C23H26N6O5S and a molecular weight of 498.57 g/mol. Its IUPAC name is 5-[1-[1-(4-methoxy-2-methylphenyl)-6-methyl-2,3-dihydropyrrolo[2,3-b]pyridin-4-yl]pyrazol-3-yl]-2-methyl-1,1-dioxo-1,2,5-thiadiazolidin-2-ium-2-carboxylate.
| Compound Name | 5-[1-[1-(4-methoxy-2-methylphenyl)-6-methyl-2,3-dihydropyrrolo[2,3-b]pyridin-4-yl]pyrazol-3-yl]-2-methyl-1,1-dioxo-1,2,5-thiadiazolidin-2-ium-2-carboxylate |
|---|---|
| PubChem CID | 68643585 |
| Molecular Formula | C23H26N6O5S |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 5-[1-[1-(4-methoxy-2-methylphenyl)-6-methyl-2,3-dihydropyrrolo[2,3-b]pyridin-4-yl]pyrazol-3-yl]-2-methyl-1,1-dioxo-1,2,5-thiadiazolidin-2-ium-2-carboxylate |
| SMILES | COc1ccc(N2CCc3c(-n4ccc(N5CC[N+](C)(C(=O)[O-])S5(=O)=O)n4)cc(C)nc32)c(C)c1 |
| InChI | InChI=1S/C23H26N6O5S/c1-15-13-17(34-4)5-6-19(15)26-9-7-18-20(14-16(2)24-22(18)26)27-10-8-21(25-27)28-11-12-29(3,23(30)31)35(28,32)33/h5-6,8,10,13-14H,7,9,11-12H2,1-4H3 |
| InChIKey | OHAFJXRKXPLMHQ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 120.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|