C17H19IN2O — CID 25157511
1-(4-ethoxy-2-methylphenyl)-4-iodo-6-methyl-2,3-dihydropyrrolo[2,3-b]pyridine (PubChem CID 25157511) has the molecular formula C17H19IN2O and a molecular weight of 394.26 g/mol. Its IUPAC name is 1-(4-ethoxy-2-methylphenyl)-4-iodo-6-methyl-2,3-dihydropyrrolo[2,3-b]pyridine.
| Compound Name | 1-(4-ethoxy-2-methylphenyl)-4-iodo-6-methyl-2,3-dihydropyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 25157511 |
| Molecular Formula | C17H19IN2O |
| Molecular Weight | 394.26 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 1-(4-ethoxy-2-methylphenyl)-4-iodo-6-methyl-2,3-dihydropyrrolo[2,3-b]pyridine |
| SMILES | CCOc1ccc(N2CCc3c(I)cc(C)nc32)c(C)c1 |
| InChI | InChI=1S/C17H19IN2O/c1-4-21-13-5-6-16(11(2)9-13)20-8-7-14-15(18)10-12(3)19-17(14)20/h5-6,9-10H,4,7-8H2,1-3H3 |
| InChIKey | BHZWTDYGGQDOIT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.26 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|