About methyl 2-aminobenzoate;5-methyl-2-phenyl-4H-pyrazol-3-one
methyl 2-aminobenzoate;5-methyl-2-phenyl-4H-pyrazol-3-one (PubChem CID 68644743) has the molecular formula C18H19N3O3
and a molecular weight of 325.37 g/mol. Its IUPAC name is methyl 2-aminobenzoate;5-methyl-2-phenyl-4H-pyrazol-3-one.
Molecular Properties
| Compound Name | methyl 2-aminobenzoate;5-methyl-2-phenyl-4H-pyrazol-3-one |
| PubChem CID | 68644743 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | methyl 2-aminobenzoate;5-methyl-2-phenyl-4H-pyrazol-3-one |
| SMILES | CC1=NN(c2ccccc2)C(=O)C1.COC(=O)c1ccccc1N |
| InChI | InChI=1S/C10H10N2O.C8H9NO2/c1-8-7-10(13)12(11-8)9-5-3-2-4-6-9;1-11-8(10)6-4-2-3-5-7(6)9/h2-6H,7H2,1H3;2-5H,9H2,1H3 |
| InChIKey | HSXCRQGGFPGWJP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-aminobenzoate;5-methyl-2-phenyl-4H-pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-aminobenzoate;5-methyl-2-phenyl-4H-pyrazol-3-one?
The IUPAC name of methyl 2-aminobenzoate;5-methyl-2-phenyl-4H-pyrazol-3-one (CID 68644743) is methyl 2-aminobenzoate;5-methyl-2-phenyl-4H-pyrazol-3-one.
What is the SMILES notation for methyl 2-aminobenzoate;5-methyl-2-phenyl-4H-pyrazol-3-one?
The canonical SMILES for methyl 2-aminobenzoate;5-methyl-2-phenyl-4H-pyrazol-3-one is CC1=NN(c2ccccc2)C(=O)C1.COC(=O)c1ccccc1N.
What is the InChIKey of methyl 2-aminobenzoate;5-methyl-2-phenyl-4H-pyrazol-3-one?
The InChIKey is HSXCRQGGFPGWJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O.C8H9NO2/c1-8-7-10(13)12(11-8)9-5-3-2-4-6-9;1-11-8(10)6-4-2-3-5-7(6)9/h2-6H,7H2,1H3;2-5H,9H2,1H3.
What are the key properties of methyl 2-aminobenzoate;5-methyl-2-phenyl-4H-pyrazol-3-one?
methyl 2-aminobenzoate;5-methyl-2-phenyl-4H-pyrazol-3-one has a molecular weight of 325.37 g/mol, XLogP of 2.85, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-aminobenzoate;5-methyl-2-phenyl-4H-pyrazol-3-one is sourced from PubChem (CID 68644743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).